C14H20NO2P — CID 58361523
(1S,3R,3aS)-3-phenyl-1-propan-2-yloxy-3a,4,5,6-tetrahydro-3H-pyrrolo[1,2-c][1,3,2]oxazaphosphole (PubChem CID 58361523) has the molecular formula C14H20NO2P and a molecular weight of 265.29 g/mol. Its IUPAC name is (1S,3R,3aS)-3-phenyl-1-propan-2-yloxy-3a,4,5,6-tetrahydro-3H-pyrrolo[1,2-c][1,3,2]oxazaphosphole.
| Compound Name | (1S,3R,3aS)-3-phenyl-1-propan-2-yloxy-3a,4,5,6-tetrahydro-3H-pyrrolo[1,2-c][1,3,2]oxazaphosphole |
|---|---|
| PubChem CID | 58361523 |
| Molecular Formula | C14H20NO2P |
| Molecular Weight | 265.29 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | (1S,3R,3aS)-3-phenyl-1-propan-2-yloxy-3a,4,5,6-tetrahydro-3H-pyrrolo[1,2-c][1,3,2]oxazaphosphole |
| SMILES | CC(C)O[P@@]1O[C@H](c2ccccc2)[C@@H]2CCCN21 |
| InChI | InChI=1S/C14H20NO2P/c1-11(2)16-18-15-10-6-9-13(15)14(17-18)12-7-4-3-5-8-12/h3-5,7-8,11,13-14H,6,9-10H2,1-2H3/t13-,14+,18-/m0/s1 |
| InChIKey | SUHHZIZXOQMQEX-IYOUNJFTSA-N |
| XLogP | 3.87 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.29 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|