C11H20NOW- — CID 58361828
4,4,5,5-tetramethyl-3-(2-methylpropyl)-1,2-oxazole;tungsten (PubChem CID 58361828) has the molecular formula C11H20NOW- and a molecular weight of 366.13 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-3-(2-methylpropyl)-1,2-oxazole;tungsten.
| Compound Name | 4,4,5,5-tetramethyl-3-(2-methylpropyl)-1,2-oxazole;tungsten |
|---|---|
| PubChem CID | 58361828 |
| Molecular Formula | C11H20NOW- |
| Molecular Weight | 366.13 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | 4,4,5,5-tetramethyl-3-(2-methylpropyl)-1,2-oxazole;tungsten |
| SMILES | C[C-](C)CC1=NOC(C)(C)C1(C)C.[W] |
| InChI | InChI=1S/C11H20NO.W/c1-8(2)7-9-10(3,4)11(5,6)13-12-9;/h7H2,1-6H3;/q-1; |
| InChIKey | XCEBKTDTGCCCLX-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.13 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|