C5H3F6N3O3S — CID 58361881
2,2,2-trifluoroethyl 5-(trifluoromethyl)-1H-1,2,4-triazole-3-sulfonate (PubChem CID 58361881) has the molecular formula C5H3F6N3O3S and a molecular weight of 299.15 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl 5-(trifluoromethyl)-1H-1,2,4-triazole-3-sulfonate.
| Compound Name | 2,2,2-trifluoroethyl 5-(trifluoromethyl)-1H-1,2,4-triazole-3-sulfonate |
|---|---|
| PubChem CID | 58361881 |
| Molecular Formula | C5H3F6N3O3S |
| Molecular Weight | 299.15 g/mol |
| Exact Mass | 298.98 |
| IUPAC Name | 2,2,2-trifluoroethyl 5-(trifluoromethyl)-1H-1,2,4-triazole-3-sulfonate |
| SMILES | O=S(=O)(OCC(F)(F)F)c1n[nH]c(C(F)(F)F)n1 |
| InChI | InChI=1S/C5H3F6N3O3S/c6-4(7,8)1-17-18(15,16)3-12-2(13-14-3)5(9,10)11/h1H2,(H,12,13,14) |
| InChIKey | KJNJYCDFXREYOG-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.15 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|