About 5-(trifluoromethyl)-1H-1,2,4-triazole-3-diazonium
5-(trifluoromethyl)-1H-1,2,4-triazole-3-diazonium (PubChem CID 58361891) has the molecular formula C3HF3N5+
and a molecular weight of 164.07 g/mol. Its IUPAC name is 5-(trifluoromethyl)-1H-1,2,4-triazole-3-diazonium.
Molecular Properties
| Compound Name | 5-(trifluoromethyl)-1H-1,2,4-triazole-3-diazonium |
| PubChem CID | 58361891 |
| Molecular Formula | C3HF3N5+ |
| Molecular Weight | 164.07 g/mol |
| Exact Mass | 164.02 |
| IUPAC Name | 5-(trifluoromethyl)-1H-1,2,4-triazole-3-diazonium |
| SMILES | N#[N+]c1n[nH]c(C(F)(F)F)n1 |
| InChI | InChI=1S/C3HF3N5/c4-3(5,6)1-8-2(9-7)11-10-1/h(H,8,10,11)/q+1 |
| InChIKey | RRIKWPACMFGCFG-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.07 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'} |
|---|
Analyze 5-(trifluoromethyl)-1H-1,2,4-triazole-3-diazonium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(trifluoromethyl)-1H-1,2,4-triazole-3-diazonium?
The IUPAC name of 5-(trifluoromethyl)-1H-1,2,4-triazole-3-diazonium (CID 58361891) is 5-(trifluoromethyl)-1H-1,2,4-triazole-3-diazonium.
What is the SMILES notation for 5-(trifluoromethyl)-1H-1,2,4-triazole-3-diazonium?
The canonical SMILES for 5-(trifluoromethyl)-1H-1,2,4-triazole-3-diazonium is N#[N+]c1n[nH]c(C(F)(F)F)n1.
What is the InChIKey of 5-(trifluoromethyl)-1H-1,2,4-triazole-3-diazonium?
The InChIKey is RRIKWPACMFGCFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C3HF3N5/c4-3(5,6)1-8-2(9-7)11-10-1/h(H,8,10,11)/q+1.
What are the key properties of 5-(trifluoromethyl)-1H-1,2,4-triazole-3-diazonium?
5-(trifluoromethyl)-1H-1,2,4-triazole-3-diazonium has a molecular weight of 164.07 g/mol, XLogP of 1.31, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(trifluoromethyl)-1H-1,2,4-triazole-3-diazonium is sourced from PubChem (CID 58361891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).