About potassium 5-(trifluoromethyl)-1,2-diaza-4-azanidacyclopenta-2,5-diene-3-sulfonyl fluoride
potassium 5-(trifluoromethyl)-1,2-diaza-4-azanidacyclopenta-2,5-diene-3-sulfonyl fluoride (PubChem CID 58361898) has the molecular formula C3F4KN3O2S
and a molecular weight of 257.21 g/mol. Its IUPAC name is potassium 5-(trifluoromethyl)-1,2-diaza-4-azanidacyclopenta-2,5-diene-3-sulfonyl fluoride.
Molecular Properties
| Compound Name | potassium 5-(trifluoromethyl)-1,2-diaza-4-azanidacyclopenta-2,5-diene-3-sulfonyl fluoride |
| PubChem CID | 58361898 |
| Molecular Formula | C3F4KN3O2S |
| Molecular Weight | 257.21 g/mol |
| Exact Mass | 256.93 |
| IUPAC Name | potassium 5-(trifluoromethyl)-1,2-diaza-4-azanidacyclopenta-2,5-diene-3-sulfonyl fluoride |
| SMILES | O=S(=O)(F)c1nnc(C(F)(F)F)[n-]1.[K+] |
| InChI | InChI=1S/C3F4N3O2S.K/c4-3(5,6)1-8-2(10-9-1)13(7,11)12;/q-1;+1 |
| InChIKey | PTAXTWCMWDBXQC-UHFFFAOYSA-N |
| XLogP | -2.89 |
| TPSA | 74.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.21 |
| LogP ≤ 5 | -2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze potassium 5-(trifluoromethyl)-1,2-diaza-4-azanidacyclopenta-2,5-diene-3-sulfonyl fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium 5-(trifluoromethyl)-1,2-diaza-4-azanidacyclopenta-2,5-diene-3-sulfonyl fluoride?
The IUPAC name of potassium 5-(trifluoromethyl)-1,2-diaza-4-azanidacyclopenta-2,5-diene-3-sulfonyl fluoride (CID 58361898) is potassium 5-(trifluoromethyl)-1,2-diaza-4-azanidacyclopenta-2,5-diene-3-sulfonyl fluoride.
What is the SMILES notation for potassium 5-(trifluoromethyl)-1,2-diaza-4-azanidacyclopenta-2,5-diene-3-sulfonyl fluoride?
The canonical SMILES for potassium 5-(trifluoromethyl)-1,2-diaza-4-azanidacyclopenta-2,5-diene-3-sulfonyl fluoride is O=S(=O)(F)c1nnc(C(F)(F)F)[n-]1.[K+].
What is the InChIKey of potassium 5-(trifluoromethyl)-1,2-diaza-4-azanidacyclopenta-2,5-diene-3-sulfonyl fluoride?
The InChIKey is PTAXTWCMWDBXQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C3F4N3O2S.K/c4-3(5,6)1-8-2(10-9-1)13(7,11)12;/q-1;+1.
What are the key properties of potassium 5-(trifluoromethyl)-1,2-diaza-4-azanidacyclopenta-2,5-diene-3-sulfonyl fluoride?
potassium 5-(trifluoromethyl)-1,2-diaza-4-azanidacyclopenta-2,5-diene-3-sulfonyl fluoride has a molecular weight of 257.21 g/mol, XLogP of -2.89, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for potassium 5-(trifluoromethyl)-1,2-diaza-4-azanidacyclopenta-2,5-diene-3-sulfonyl fluoride is sourced from PubChem (CID 58361898), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).