C5H3F6N3 — CID 58361917
3-fluoro-5-(1,1,2,2,3-pentafluoropropyl)-1H-1,2,4-triazole (PubChem CID 58361917) has the molecular formula C5H3F6N3 and a molecular weight of 219.09 g/mol. Its IUPAC name is 3-fluoro-5-(1,1,2,2,3-pentafluoropropyl)-1H-1,2,4-triazole.
| Compound Name | 3-fluoro-5-(1,1,2,2,3-pentafluoropropyl)-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 58361917 |
| Molecular Formula | C5H3F6N3 |
| Molecular Weight | 219.09 g/mol |
| Exact Mass | 219.02 |
| IUPAC Name | 3-fluoro-5-(1,1,2,2,3-pentafluoropropyl)-1H-1,2,4-triazole |
| SMILES | FCC(F)(F)C(F)(F)c1nc(F)n[nH]1 |
| InChI | InChI=1S/C5H3F6N3/c6-1-4(8,9)5(10,11)2-12-3(7)14-13-2/h1H2,(H,12,13,14) |
| InChIKey | ZABHCDVMPKKWDU-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.09 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|