C7H12F4O4S — CID 58361960
(4-ethoxy-2,2,3,3-tetrafluorobutyl) methanesulfonate (PubChem CID 58361960) has the molecular formula C7H12F4O4S and a molecular weight of 268.23 g/mol. Its IUPAC name is (4-ethoxy-2,2,3,3-tetrafluorobutyl) methanesulfonate.
| Compound Name | (4-ethoxy-2,2,3,3-tetrafluorobutyl) methanesulfonate |
|---|---|
| PubChem CID | 58361960 |
| Molecular Formula | C7H12F4O4S |
| Molecular Weight | 268.23 g/mol |
| Exact Mass | 268.04 |
| IUPAC Name | (4-ethoxy-2,2,3,3-tetrafluorobutyl) methanesulfonate |
| SMILES | CCOCC(F)(F)C(F)(F)COS(C)(=O)=O |
| InChI | InChI=1S/C7H12F4O4S/c1-3-14-4-6(8,9)7(10,11)5-15-16(2,12)13/h3-5H2,1-2H3 |
| InChIKey | TZGMFPCXQFFAJX-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.23 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|