C8H13F4N — CID 58361970
1-tert-butyl-3,3,4,4-tetrafluoropyrrolidine (PubChem CID 58361970) has the molecular formula C8H13F4N and a molecular weight of 199.19 g/mol. Its IUPAC name is 1-tert-butyl-3,3,4,4-tetrafluoropyrrolidine.
| Compound Name | 1-tert-butyl-3,3,4,4-tetrafluoropyrrolidine |
|---|---|
| PubChem CID | 58361970 |
| Molecular Formula | C8H13F4N |
| Molecular Weight | 199.19 g/mol |
| Exact Mass | 199.10 |
| IUPAC Name | 1-tert-butyl-3,3,4,4-tetrafluoropyrrolidine |
| SMILES | CC(C)(C)N1CC(F)(F)C(F)(F)C1 |
| InChI | InChI=1S/C8H13F4N/c1-6(2,3)13-4-7(9,10)8(11,12)5-13/h4-5H2,1-3H3 |
| InChIKey | HLTYGZCQUJYFNQ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.19 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|