C18H4F10O4 — CID 58361971
4-(2,3,4,5,6-pentafluorobenzoyl)oxybut-2-ynyl 2,3,4,5,6-pentafluorobenzoate (PubChem CID 58361971) has the molecular formula C18H4F10O4 and a molecular weight of 474.21 g/mol. Its IUPAC name is 4-(2,3,4,5,6-pentafluorobenzoyl)oxybut-2-ynyl 2,3,4,5,6-pentafluorobenzoate.
| Compound Name | 4-(2,3,4,5,6-pentafluorobenzoyl)oxybut-2-ynyl 2,3,4,5,6-pentafluorobenzoate |
|---|---|
| PubChem CID | 58361971 |
| Molecular Formula | C18H4F10O4 |
| Molecular Weight | 474.21 g/mol |
| Exact Mass | 473.99 |
| IUPAC Name | 4-(2,3,4,5,6-pentafluorobenzoyl)oxybut-2-ynyl 2,3,4,5,6-pentafluorobenzoate |
| SMILES | O=C(OCC#CCOC(=O)c1c(F)c(F)c(F)c(F)c1F)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C18H4F10O4/c19-7-5(8(20)12(24)15(27)11(7)23)17(29)31-3-1-2-4-32-18(30)6-9(21)13(25)16(28)14(26)10(6)22/h3-4H2 |
| InChIKey | HMNSTFJVJQAWHL-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.21 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|