About (2-methyl-1,3-dithian-2-yl)-phenylmethanol
(2-methyl-1,3-dithian-2-yl)-phenylmethanol (PubChem CID 583621) has the molecular formula C12H16OS2
and a molecular weight of 240.39 g/mol. Its IUPAC name is (2-methyl-1,3-dithian-2-yl)-phenylmethanol.
Molecular Properties
| Compound Name | (2-methyl-1,3-dithian-2-yl)-phenylmethanol |
| PubChem CID | 583621 |
| Molecular Formula | C12H16OS2 |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.06 |
| IUPAC Name | (2-methyl-1,3-dithian-2-yl)-phenylmethanol |
| SMILES | CC1(C(O)c2ccccc2)SCCCS1 |
| InChI | InChI=1S/C12H16OS2/c1-12(14-8-5-9-15-12)11(13)10-6-3-2-4-7-10/h2-4,6-7,11,13H,5,8-9H2,1H3 |
| InChIKey | BZVZJQMZXYNOTI-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2-methyl-1,3-dithian-2-yl)-phenylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methyl-1,3-dithian-2-yl)-phenylmethanol?
The IUPAC name of (2-methyl-1,3-dithian-2-yl)-phenylmethanol (CID 583621) is (2-methyl-1,3-dithian-2-yl)-phenylmethanol.
What is the SMILES notation for (2-methyl-1,3-dithian-2-yl)-phenylmethanol?
The canonical SMILES for (2-methyl-1,3-dithian-2-yl)-phenylmethanol is CC1(C(O)c2ccccc2)SCCCS1.
What is the InChIKey of (2-methyl-1,3-dithian-2-yl)-phenylmethanol?
The InChIKey is BZVZJQMZXYNOTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16OS2/c1-12(14-8-5-9-15-12)11(13)10-6-3-2-4-7-10/h2-4,6-7,11,13H,5,8-9H2,1H3.
What are the key properties of (2-methyl-1,3-dithian-2-yl)-phenylmethanol?
(2-methyl-1,3-dithian-2-yl)-phenylmethanol has a molecular weight of 240.39 g/mol, XLogP of 3.31, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methyl-1,3-dithian-2-yl)-phenylmethanol is sourced from PubChem (CID 583621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).