About [3-(6-fluoro-3-pyridinyl)pyrido[1,2-a]benzimidazol-8-yl] trifluoromethanesulfonate
[3-(6-fluoro-3-pyridinyl)pyrido[1,2-a]benzimidazol-8-yl] trifluoromethanesulfonate (PubChem CID 58362352) has the molecular formula C17H9F4N3O3S
and a molecular weight of 411.34 g/mol. Its IUPAC name is [3-(6-fluoro-3-pyridinyl)pyrido[1,2-a]benzimidazol-8-yl] trifluoromethanesulfonate.
Molecular Properties
| Compound Name | [3-(6-fluoro-3-pyridinyl)pyrido[1,2-a]benzimidazol-8-yl] trifluoromethanesulfonate |
| PubChem CID | 58362352 |
| Molecular Formula | C17H9F4N3O3S |
| Molecular Weight | 411.34 g/mol |
| Exact Mass | 411.03 |
| IUPAC Name | [3-(6-fluoro-3-pyridinyl)pyrido[1,2-a]benzimidazol-8-yl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1ccc2nc3cc(-c4ccc(F)nc4)ccn3c2c1)C(F)(F)F |
| InChI | InChI=1S/C17H9F4N3O3S/c18-15-4-1-11(9-22-15)10-5-6-24-14-8-12(27-28(25,26)17(19,20)21)2-3-13(14)23-16(24)7-10/h1-9H |
| InChIKey | SYTFSVPEBQRBCR-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 73.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 411.34 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze [3-(6-fluoro-3-pyridinyl)pyrido[1,2-a]benzimidazol-8-yl] trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(6-fluoro-3-pyridinyl)pyrido[1,2-a]benzimidazol-8-yl] trifluoromethanesulfonate?
The IUPAC name of [3-(6-fluoro-3-pyridinyl)pyrido[1,2-a]benzimidazol-8-yl] trifluoromethanesulfonate (CID 58362352) is [3-(6-fluoro-3-pyridinyl)pyrido[1,2-a]benzimidazol-8-yl] trifluoromethanesulfonate.
What is the SMILES notation for [3-(6-fluoro-3-pyridinyl)pyrido[1,2-a]benzimidazol-8-yl] trifluoromethanesulfonate?
The canonical SMILES for [3-(6-fluoro-3-pyridinyl)pyrido[1,2-a]benzimidazol-8-yl] trifluoromethanesulfonate is O=S(=O)(Oc1ccc2nc3cc(-c4ccc(F)nc4)ccn3c2c1)C(F)(F)F.
What is the InChIKey of [3-(6-fluoro-3-pyridinyl)pyrido[1,2-a]benzimidazol-8-yl] trifluoromethanesulfonate?
The InChIKey is SYTFSVPEBQRBCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H9F4N3O3S/c18-15-4-1-11(9-22-15)10-5-6-24-14-8-12(27-28(25,26)17(19,20)21)2-3-13(14)23-16(24)7-10/h1-9H.
What are the key properties of [3-(6-fluoro-3-pyridinyl)pyrido[1,2-a]benzimidazol-8-yl] trifluoromethanesulfonate?
[3-(6-fluoro-3-pyridinyl)pyrido[1,2-a]benzimidazol-8-yl] trifluoromethanesulfonate has a molecular weight of 411.34 g/mol, XLogP of 3.92, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(6-fluoro-3-pyridinyl)pyrido[1,2-a]benzimidazol-8-yl] trifluoromethanesulfonate is sourced from PubChem (CID 58362352), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).