About 6-[2-(5-fluoro-[1,3]oxazolo[4,5-b]pyridin-2-yl)ethynyl]-N-methylpyridin-3-amine
6-[2-(5-fluoro-[1,3]oxazolo[4,5-b]pyridin-2-yl)ethynyl]-N-methylpyridin-3-amine (PubChem CID 58362608) has the molecular formula C14H9FN4O
and a molecular weight of 268.25 g/mol. Its IUPAC name is 6-[2-(5-fluoro-[1,3]oxazolo[4,5-b]pyridin-2-yl)ethynyl]-N-methylpyridin-3-amine.
Molecular Properties
| Compound Name | 6-[2-(5-fluoro-[1,3]oxazolo[4,5-b]pyridin-2-yl)ethynyl]-N-methylpyridin-3-amine |
| PubChem CID | 58362608 |
| Molecular Formula | C14H9FN4O |
| Molecular Weight | 268.25 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | 6-[2-(5-fluoro-[1,3]oxazolo[4,5-b]pyridin-2-yl)ethynyl]-N-methylpyridin-3-amine |
| SMILES | CNc1ccc(C#Cc2nc3nc(F)ccc3o2)nc1 |
| InChI | InChI=1S/C14H9FN4O/c1-16-10-3-2-9(17-8-10)4-7-13-19-14-11(20-13)5-6-12(15)18-14/h2-3,5-6,8,16H,1H3 |
| InChIKey | IHSRGDIPDPMOQQ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 63.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.25 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-[2-(5-fluoro-[1,3]oxazolo[4,5-b]pyridin-2-yl)ethynyl]-N-methylpyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[2-(5-fluoro-[1,3]oxazolo[4,5-b]pyridin-2-yl)ethynyl]-N-methylpyridin-3-amine?
The IUPAC name of 6-[2-(5-fluoro-[1,3]oxazolo[4,5-b]pyridin-2-yl)ethynyl]-N-methylpyridin-3-amine (CID 58362608) is 6-[2-(5-fluoro-[1,3]oxazolo[4,5-b]pyridin-2-yl)ethynyl]-N-methylpyridin-3-amine.
What is the SMILES notation for 6-[2-(5-fluoro-[1,3]oxazolo[4,5-b]pyridin-2-yl)ethynyl]-N-methylpyridin-3-amine?
The canonical SMILES for 6-[2-(5-fluoro-[1,3]oxazolo[4,5-b]pyridin-2-yl)ethynyl]-N-methylpyridin-3-amine is CNc1ccc(C#Cc2nc3nc(F)ccc3o2)nc1.
What is the InChIKey of 6-[2-(5-fluoro-[1,3]oxazolo[4,5-b]pyridin-2-yl)ethynyl]-N-methylpyridin-3-amine?
The InChIKey is IHSRGDIPDPMOQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9FN4O/c1-16-10-3-2-9(17-8-10)4-7-13-19-14-11(20-13)5-6-12(15)18-14/h2-3,5-6,8,16H,1H3.
What are the key properties of 6-[2-(5-fluoro-[1,3]oxazolo[4,5-b]pyridin-2-yl)ethynyl]-N-methylpyridin-3-amine?
6-[2-(5-fluoro-[1,3]oxazolo[4,5-b]pyridin-2-yl)ethynyl]-N-methylpyridin-3-amine has a molecular weight of 268.25 g/mol, XLogP of 2.20, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[2-(5-fluoro-[1,3]oxazolo[4,5-b]pyridin-2-yl)ethynyl]-N-methylpyridin-3-amine is sourced from PubChem (CID 58362608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).