About N-methyl-5-[2-([1,3]oxazolo[5,4-b]pyridin-2-yl)ethynyl]pyridin-2-amine
N-methyl-5-[2-([1,3]oxazolo[5,4-b]pyridin-2-yl)ethynyl]pyridin-2-amine (PubChem CID 58362690) has the molecular formula C14H10N4O
and a molecular weight of 250.26 g/mol. Its IUPAC name is N-methyl-5-[2-([1,3]oxazolo[5,4-b]pyridin-2-yl)ethynyl]pyridin-2-amine.
Molecular Properties
| Compound Name | N-methyl-5-[2-([1,3]oxazolo[5,4-b]pyridin-2-yl)ethynyl]pyridin-2-amine |
| PubChem CID | 58362690 |
| Molecular Formula | C14H10N4O |
| Molecular Weight | 250.26 g/mol |
| Exact Mass | 250.09 |
| IUPAC Name | N-methyl-5-[2-([1,3]oxazolo[5,4-b]pyridin-2-yl)ethynyl]pyridin-2-amine |
| SMILES | CNc1ccc(C#Cc2nc3cccnc3o2)cn1 |
| InChI | InChI=1S/C14H10N4O/c1-15-12-6-4-10(9-17-12)5-7-13-18-11-3-2-8-16-14(11)19-13/h2-4,6,8-9H,1H3,(H,15,17) |
| InChIKey | WXRRAEGEYPQLJJ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 63.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.26 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze N-methyl-5-[2-([1,3]oxazolo[5,4-b]pyridin-2-yl)ethynyl]pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-5-[2-([1,3]oxazolo[5,4-b]pyridin-2-yl)ethynyl]pyridin-2-amine?
The IUPAC name of N-methyl-5-[2-([1,3]oxazolo[5,4-b]pyridin-2-yl)ethynyl]pyridin-2-amine (CID 58362690) is N-methyl-5-[2-([1,3]oxazolo[5,4-b]pyridin-2-yl)ethynyl]pyridin-2-amine.
What is the SMILES notation for N-methyl-5-[2-([1,3]oxazolo[5,4-b]pyridin-2-yl)ethynyl]pyridin-2-amine?
The canonical SMILES for N-methyl-5-[2-([1,3]oxazolo[5,4-b]pyridin-2-yl)ethynyl]pyridin-2-amine is CNc1ccc(C#Cc2nc3cccnc3o2)cn1.
What is the InChIKey of N-methyl-5-[2-([1,3]oxazolo[5,4-b]pyridin-2-yl)ethynyl]pyridin-2-amine?
The InChIKey is WXRRAEGEYPQLJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10N4O/c1-15-12-6-4-10(9-17-12)5-7-13-18-11-3-2-8-16-14(11)19-13/h2-4,6,8-9H,1H3,(H,15,17).
What are the key properties of N-methyl-5-[2-([1,3]oxazolo[5,4-b]pyridin-2-yl)ethynyl]pyridin-2-amine?
N-methyl-5-[2-([1,3]oxazolo[5,4-b]pyridin-2-yl)ethynyl]pyridin-2-amine has a molecular weight of 250.26 g/mol, XLogP of 2.06, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-5-[2-([1,3]oxazolo[5,4-b]pyridin-2-yl)ethynyl]pyridin-2-amine is sourced from PubChem (CID 58362690), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).