C30H33ClN2O5 — CID 58362749
(11S,16R,17R)-17-[2-(6-chloroquinoxalin-2-yl)oxyacetyl]-11,17-dihydroxy-10,13,16-trimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-one (PubChem CID 58362749) has the molecular formula C30H33ClN2O5 and a molecular weight of 537.06 g/mol. Its IUPAC name is (11S,16R,17R)-17-[2-(6-chloroquinoxalin-2-yl)oxyacetyl]-11,17-dihydroxy-10,13,16-trimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (11S,16R,17R)-17-[2-(6-chloroquinoxalin-2-yl)oxyacetyl]-11,17-dihydroxy-10,13,16-trimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 58362749 |
| Molecular Formula | C30H33ClN2O5 |
| Molecular Weight | 537.06 g/mol |
| Exact Mass | 536.21 |
| IUPAC Name | (11S,16R,17R)-17-[2-(6-chloroquinoxalin-2-yl)oxyacetyl]-11,17-dihydroxy-10,13,16-trimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-one |
| SMILES | C[C@@H]1CC2C3CCC4=CC(=O)C=CC4(C)C3C(O)CC2(C)[C@@]1(O)C(=O)COc1cnc2cc(Cl)ccc2n1 |
| InChI | InChI=1S/C30H33ClN2O5/c1-16-10-21-20-6-4-17-11-19(34)8-9-28(17,2)27(20)24(35)13-29(21,3)30(16,37)25(36)15-38-26-14-32-23-12-18(31)5-7-22(23)33-26/h5,7-9,11-12,14,16,20-21,24,27,35,37H,4,6,10,13,15H2,1-3H3/t16-,20?,21?,24?,27?,28?,29?,30+/m1/s1 |
| InChIKey | JWHBXEMAIXBUJA-PDYOKEPMSA-N |
| XLogP | 4.49 |
| TPSA | 109.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.06 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |