C34H37FO5S — CID 58362877
(9R,11S,16R,17R)-9-fluoro-11,17-dihydroxy-10,13,16-trimethyl-17-[2-(4-phenoxyphenyl)sulfanylacetyl]-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one (PubChem CID 58362877) has the molecular formula C34H37FO5S and a molecular weight of 576.73 g/mol. Its IUPAC name is (9R,11S,16R,17R)-9-fluoro-11,17-dihydroxy-10,13,16-trimethyl-17-[2-(4-phenoxyphenyl)sulfanylacetyl]-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (9R,11S,16R,17R)-9-fluoro-11,17-dihydroxy-10,13,16-trimethyl-17-[2-(4-phenoxyphenyl)sulfanylacetyl]-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 58362877 |
| Molecular Formula | C34H37FO5S |
| Molecular Weight | 576.73 g/mol |
| Exact Mass | 576.23 |
| IUPAC Name | (9R,11S,16R,17R)-9-fluoro-11,17-dihydroxy-10,13,16-trimethyl-17-[2-(4-phenoxyphenyl)sulfanylacetyl]-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one |
| SMILES | C[C@@H]1CC2C3CCC4=CC(=O)C=CC4(C)[C@@]3(F)[C@@H](O)CC2(C)[C@@]1(O)C(=O)CSc1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C34H37FO5S/c1-21-17-28-27-14-9-22-18-23(36)15-16-31(22,2)33(27,35)29(37)19-32(28,3)34(21,39)30(38)20-41-26-12-10-25(11-13-26)40-24-7-5-4-6-8-24/h4-8,10-13,15-16,18,21,27-29,37,39H,9,14,17,19-20H2,1-3H3/t21-,27?,28?,29+,31?,32?,33+,34+/m1/s1 |
| InChIKey | ZRSRRALTOKDMAH-QCQCGUTKSA-N |
| XLogP | 6.49 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.73 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |