C27H35NO4 — CID 58363235
(11S,17R)-N-benzyl-11,17-dihydroxy-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-17-carboxamide (PubChem CID 58363235) has the molecular formula C27H35NO4 and a molecular weight of 437.58 g/mol. Its IUPAC name is (11S,17R)-N-benzyl-11,17-dihydroxy-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-17-carboxamide.
| Compound Name | (11S,17R)-N-benzyl-11,17-dihydroxy-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-17-carboxamide |
|---|---|
| PubChem CID | 58363235 |
| Molecular Formula | C27H35NO4 |
| Molecular Weight | 437.58 g/mol |
| Exact Mass | 437.26 |
| IUPAC Name | (11S,17R)-N-benzyl-11,17-dihydroxy-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-17-carboxamide |
| SMILES | CC12CCC(=O)C=C1CCC1C2C(O)CC2(C)C1CC[C@]2(O)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C27H35NO4/c1-25-12-10-19(29)14-18(25)8-9-20-21-11-13-27(32,26(21,2)15-22(30)23(20)25)24(31)28-16-17-6-4-3-5-7-17/h3-7,14,20-23,30,32H,8-13,15-16H2,1-2H3,(H,28,31)/t20?,21?,22?,23?,25?,26?,27-/m0/s1 |
| InChIKey | FSSOAUHEKDLIEW-MEEBUVQVSA-N |
| XLogP | 3.54 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.58 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |