About 2-cyclohexylpropan-2-yl 2-methyl-3-oxo-2-[[4-(trifluoromethyl)phenyl]sulfonyloxymethyl]butanoate
2-cyclohexylpropan-2-yl 2-methyl-3-oxo-2-[[4-(trifluoromethyl)phenyl]sulfonyloxymethyl]butanoate (PubChem CID 58363863) has the molecular formula C22H29F3O6S
and a molecular weight of 478.53 g/mol. Its IUPAC name is 2-cyclohexylpropan-2-yl 2-methyl-3-oxo-2-[[4-(trifluoromethyl)phenyl]sulfonyloxymethyl]butanoate.
Molecular Properties
| Compound Name | 2-cyclohexylpropan-2-yl 2-methyl-3-oxo-2-[[4-(trifluoromethyl)phenyl]sulfonyloxymethyl]butanoate |
| PubChem CID | 58363863 |
| Molecular Formula | C22H29F3O6S |
| Molecular Weight | 478.53 g/mol |
| Exact Mass | 478.16 |
| IUPAC Name | 2-cyclohexylpropan-2-yl 2-methyl-3-oxo-2-[[4-(trifluoromethyl)phenyl]sulfonyloxymethyl]butanoate |
| SMILES | CC(=O)C(C)(COS(=O)(=O)c1ccc(C(F)(F)F)cc1)C(=O)OC(C)(C)C1CCCCC1 |
| InChI | InChI=1S/C22H29F3O6S/c1-15(26)21(4,19(27)31-20(2,3)16-8-6-5-7-9-16)14-30-32(28,29)18-12-10-17(11-13-18)22(23,24)25/h10-13,16H,5-9,14H2,1-4H3 |
| InChIKey | GTTCWPKAACFYBQ-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 478.53 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 2-cyclohexylpropan-2-yl 2-methyl-3-oxo-2-[[4-(trifluoromethyl)phenyl]sulfonyloxymethyl]butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclohexylpropan-2-yl 2-methyl-3-oxo-2-[[4-(trifluoromethyl)phenyl]sulfonyloxymethyl]butanoate?
The IUPAC name of 2-cyclohexylpropan-2-yl 2-methyl-3-oxo-2-[[4-(trifluoromethyl)phenyl]sulfonyloxymethyl]butanoate (CID 58363863) is 2-cyclohexylpropan-2-yl 2-methyl-3-oxo-2-[[4-(trifluoromethyl)phenyl]sulfonyloxymethyl]butanoate.
What is the SMILES notation for 2-cyclohexylpropan-2-yl 2-methyl-3-oxo-2-[[4-(trifluoromethyl)phenyl]sulfonyloxymethyl]butanoate?
The canonical SMILES for 2-cyclohexylpropan-2-yl 2-methyl-3-oxo-2-[[4-(trifluoromethyl)phenyl]sulfonyloxymethyl]butanoate is CC(=O)C(C)(COS(=O)(=O)c1ccc(C(F)(F)F)cc1)C(=O)OC(C)(C)C1CCCCC1.
What is the InChIKey of 2-cyclohexylpropan-2-yl 2-methyl-3-oxo-2-[[4-(trifluoromethyl)phenyl]sulfonyloxymethyl]butanoate?
The InChIKey is GTTCWPKAACFYBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H29F3O6S/c1-15(26)21(4,19(27)31-20(2,3)16-8-6-5-7-9-16)14-30-32(28,29)18-12-10-17(11-13-18)22(23,24)25/h10-13,16H,5-9,14H2,1-4H3.
What are the key properties of 2-cyclohexylpropan-2-yl 2-methyl-3-oxo-2-[[4-(trifluoromethyl)phenyl]sulfonyloxymethyl]butanoate?
2-cyclohexylpropan-2-yl 2-methyl-3-oxo-2-[[4-(trifluoromethyl)phenyl]sulfonyloxymethyl]butanoate has a molecular weight of 478.53 g/mol, XLogP of 4.91, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohexylpropan-2-yl 2-methyl-3-oxo-2-[[4-(trifluoromethyl)phenyl]sulfonyloxymethyl]butanoate is sourced from PubChem (CID 58363863), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).