C16H20F2O7S — CID 58363897
2-[[4-(2,2-dimethylbutanoyloxymethyl)phenyl]methoxy]-1,1-difluoro-2-oxoethanesulfonic acid (PubChem CID 58363897) has the molecular formula C16H20F2O7S and a molecular weight of 394.39 g/mol. Its IUPAC name is 2-[[4-(2,2-dimethylbutanoyloxymethyl)phenyl]methoxy]-1,1-difluoro-2-oxoethanesulfonic acid.
| Compound Name | 2-[[4-(2,2-dimethylbutanoyloxymethyl)phenyl]methoxy]-1,1-difluoro-2-oxoethanesulfonic acid |
|---|---|
| PubChem CID | 58363897 |
| Molecular Formula | C16H20F2O7S |
| Molecular Weight | 394.39 g/mol |
| Exact Mass | 394.09 |
| IUPAC Name | 2-[[4-(2,2-dimethylbutanoyloxymethyl)phenyl]methoxy]-1,1-difluoro-2-oxoethanesulfonic acid |
| SMILES | CCC(C)(C)C(=O)OCc1ccc(COC(=O)C(F)(F)S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C16H20F2O7S/c1-4-15(2,3)13(19)24-9-11-5-7-12(8-6-11)10-25-14(20)16(17,18)26(21,22)23/h5-8H,4,9-10H2,1-3H3,(H,21,22,23) |
| InChIKey | XROGNMGBCXDFIV-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.39 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|