C18H16F6O8S3 — CID 58363915
1,1,2,2,3,3-hexafluoro-3-[4-(hydroxymethyl-methyl-prop-2-enoyl-λ4-sulfanyl)naphthalen-1-yl]oxysulfonylpropane-1-sulfonic acid (PubChem CID 58363915) has the molecular formula C18H16F6O8S3 and a molecular weight of 570.51 g/mol. Its IUPAC name is 1,1,2,2,3,3-hexafluoro-3-[4-(hydroxymethyl-methyl-prop-2-enoyl-λ4-sulfanyl)naphthalen-1-yl]oxysulfonylpropane-1-sulfonic acid.
| Compound Name | 1,1,2,2,3,3-hexafluoro-3-[4-(hydroxymethyl-methyl-prop-2-enoyl-λ4-sulfanyl)naphthalen-1-yl]oxysulfonylpropane-1-sulfonic acid |
|---|---|
| PubChem CID | 58363915 |
| Molecular Formula | C18H16F6O8S3 |
| Molecular Weight | 570.51 g/mol |
| Exact Mass | 569.99 |
| IUPAC Name | 1,1,2,2,3,3-hexafluoro-3-[4-(hydroxymethyl-methyl-prop-2-enoyl-λ4-sulfanyl)naphthalen-1-yl]oxysulfonylpropane-1-sulfonic acid |
| SMILES | C=CC(=O)S(C)(CO)c1ccc(OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)O)c2ccccc12 |
| InChI | InChI=1S/C18H16F6O8S3/c1-3-15(26)33(2,10-25)14-9-8-13(11-6-4-5-7-12(11)14)32-35(30,31)18(23,24)16(19,20)17(21,22)34(27,28)29/h3-9,25H,1,10H2,2H3,(H,27,28,29) |
| InChIKey | BNLPEJZZJYEOHS-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 135.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.51 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|