C19H19F5O6S — CID 58363946
2-[2-(6-butan-2-ylnaphthalen-2-yl)oxy-2-oxoethoxy]-1,1,3,3,3-pentafluoropropane-1-sulfonic acid (PubChem CID 58363946) has the molecular formula C19H19F5O6S and a molecular weight of 470.41 g/mol. Its IUPAC name is 2-[2-(6-butan-2-ylnaphthalen-2-yl)oxy-2-oxoethoxy]-1,1,3,3,3-pentafluoropropane-1-sulfonic acid.
| Compound Name | 2-[2-(6-butan-2-ylnaphthalen-2-yl)oxy-2-oxoethoxy]-1,1,3,3,3-pentafluoropropane-1-sulfonic acid |
|---|---|
| PubChem CID | 58363946 |
| Molecular Formula | C19H19F5O6S |
| Molecular Weight | 470.41 g/mol |
| Exact Mass | 470.08 |
| IUPAC Name | 2-[2-(6-butan-2-ylnaphthalen-2-yl)oxy-2-oxoethoxy]-1,1,3,3,3-pentafluoropropane-1-sulfonic acid |
| SMILES | CCC(C)c1ccc2cc(OC(=O)COC(C(F)(F)F)C(F)(F)S(=O)(=O)O)ccc2c1 |
| InChI | InChI=1S/C19H19F5O6S/c1-3-11(2)12-4-5-14-9-15(7-6-13(14)8-12)30-16(25)10-29-17(18(20,21)22)19(23,24)31(26,27)28/h4-9,11,17H,3,10H2,1-2H3,(H,26,27,28) |
| InChIKey | CWCHEXLCTRVHNT-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.41 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|