C17H15F5O6S — CID 58363976
2-[2-(6-ethylnaphthalen-2-yl)oxy-2-oxoethoxy]-1,1,3,3,3-pentafluoropropane-1-sulfonic acid (PubChem CID 58363976) has the molecular formula C17H15F5O6S and a molecular weight of 442.36 g/mol. Its IUPAC name is 2-[2-(6-ethylnaphthalen-2-yl)oxy-2-oxoethoxy]-1,1,3,3,3-pentafluoropropane-1-sulfonic acid.
| Compound Name | 2-[2-(6-ethylnaphthalen-2-yl)oxy-2-oxoethoxy]-1,1,3,3,3-pentafluoropropane-1-sulfonic acid |
|---|---|
| PubChem CID | 58363976 |
| Molecular Formula | C17H15F5O6S |
| Molecular Weight | 442.36 g/mol |
| Exact Mass | 442.05 |
| IUPAC Name | 2-[2-(6-ethylnaphthalen-2-yl)oxy-2-oxoethoxy]-1,1,3,3,3-pentafluoropropane-1-sulfonic acid |
| SMILES | CCc1ccc2cc(OC(=O)COC(C(F)(F)F)C(F)(F)S(=O)(=O)O)ccc2c1 |
| InChI | InChI=1S/C17H15F5O6S/c1-2-10-3-4-12-8-13(6-5-11(12)7-10)28-14(23)9-27-15(16(18,19)20)17(21,22)29(24,25)26/h3-8,15H,2,9H2,1H3,(H,24,25,26) |
| InChIKey | CNESYRFPGPTHFS-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.36 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|