C11H20O4S2 — CID 583640
2-[(2-methyl-1,3-dithian-2-yl)methyl]oxane-3,4,5-triol (PubChem CID 583640) has the molecular formula C11H20O4S2 and a molecular weight of 280.41 g/mol. Its IUPAC name is 2-[(2-methyl-1,3-dithian-2-yl)methyl]oxane-3,4,5-triol.
| Compound Name | 2-[(2-methyl-1,3-dithian-2-yl)methyl]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 583640 |
| Molecular Formula | C11H20O4S2 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | 2-[(2-methyl-1,3-dithian-2-yl)methyl]oxane-3,4,5-triol |
| SMILES | CC1(CC2OCC(O)C(O)C2O)SCCCS1 |
| InChI | InChI=1S/C11H20O4S2/c1-11(16-3-2-4-17-11)5-8-10(14)9(13)7(12)6-15-8/h7-10,12-14H,2-6H2,1H3 |
| InChIKey | XPNLVUBDCKZILB-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |