C14H17F4O8S2- — CID 58364018
1,1,2,2-tetrafluoro-2-[4-[2-(4-hydroxybutoxy)ethyl]phenoxy]sulfonylethanesulfonate (PubChem CID 58364018) has the molecular formula C14H17F4O8S2- and a molecular weight of 453.41 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-2-[4-[2-(4-hydroxybutoxy)ethyl]phenoxy]sulfonylethanesulfonate.
| Compound Name | 1,1,2,2-tetrafluoro-2-[4-[2-(4-hydroxybutoxy)ethyl]phenoxy]sulfonylethanesulfonate |
|---|---|
| PubChem CID | 58364018 |
| Molecular Formula | C14H17F4O8S2- |
| Molecular Weight | 453.41 g/mol |
| Exact Mass | 453.03 |
| IUPAC Name | 1,1,2,2-tetrafluoro-2-[4-[2-(4-hydroxybutoxy)ethyl]phenoxy]sulfonylethanesulfonate |
| SMILES | O=S(=O)([O-])C(F)(F)C(F)(F)S(=O)(=O)Oc1ccc(CCOCCCCO)cc1 |
| InChI | InChI=1S/C14H18F4O8S2/c15-13(16,27(20,21)22)14(17,18)28(23,24)26-12-5-3-11(4-6-12)7-10-25-9-2-1-8-19/h3-6,19H,1-2,7-10H2,(H,20,21,22)/p-1 |
| InChIKey | RLGZHNVRNWVNEM-UHFFFAOYSA-M |
| XLogP | 1.46 |
| TPSA | 130.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.41 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|