C16H11F4O7S2- — CID 58364021
4-[2-(4-ethenylphenoxy)sulfonylethoxy]-2,3,5,6-tetrafluorobenzenesulfonate (PubChem CID 58364021) has the molecular formula C16H11F4O7S2- and a molecular weight of 455.38 g/mol. Its IUPAC name is 4-[2-(4-ethenylphenoxy)sulfonylethoxy]-2,3,5,6-tetrafluorobenzenesulfonate.
| Compound Name | 4-[2-(4-ethenylphenoxy)sulfonylethoxy]-2,3,5,6-tetrafluorobenzenesulfonate |
|---|---|
| PubChem CID | 58364021 |
| Molecular Formula | C16H11F4O7S2- |
| Molecular Weight | 455.38 g/mol |
| Exact Mass | 454.99 |
| IUPAC Name | 4-[2-(4-ethenylphenoxy)sulfonylethoxy]-2,3,5,6-tetrafluorobenzenesulfonate |
| SMILES | C=Cc1ccc(OS(=O)(=O)CCOc2c(F)c(F)c(S(=O)(=O)[O-])c(F)c2F)cc1 |
| InChI | InChI=1S/C16H12F4O7S2/c1-2-9-3-5-10(6-4-9)27-28(21,22)8-7-26-15-11(17)13(19)16(29(23,24)25)14(20)12(15)18/h2-6H,1,7-8H2,(H,23,24,25)/p-1 |
| InChIKey | ASZVLJKISSYRJW-UHFFFAOYSA-M |
| XLogP | 2.58 |
| TPSA | 109.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.38 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|