C17H10F4O7S — CID 58364040
2,3,5,6-tetrafluoro-4-[(Z)-4-oxo-4-phenylmethoxybut-2-enoyl]oxybenzenesulfonic acid (PubChem CID 58364040) has the molecular formula C17H10F4O7S and a molecular weight of 434.32 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-4-[(Z)-4-oxo-4-phenylmethoxybut-2-enoyl]oxybenzenesulfonic acid.
| Compound Name | 2,3,5,6-tetrafluoro-4-[(Z)-4-oxo-4-phenylmethoxybut-2-enoyl]oxybenzenesulfonic acid |
|---|---|
| PubChem CID | 58364040 |
| Molecular Formula | C17H10F4O7S |
| Molecular Weight | 434.32 g/mol |
| Exact Mass | 434.01 |
| IUPAC Name | 2,3,5,6-tetrafluoro-4-[(Z)-4-oxo-4-phenylmethoxybut-2-enoyl]oxybenzenesulfonic acid |
| SMILES | O=C(/C=C\C(=O)Oc1c(F)c(F)c(S(=O)(=O)O)c(F)c1F)OCc1ccccc1 |
| InChI | InChI=1S/C17H10F4O7S/c18-12-14(20)17(29(24,25)26)15(21)13(19)16(12)28-11(23)7-6-10(22)27-8-9-4-2-1-3-5-9/h1-7H,8H2,(H,24,25,26)/b7-6- |
| InChIKey | YVENJHOSFYYXMB-SREVYHEPSA-N |
| XLogP | 2.69 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.32 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|