C24H22F6O7S2 — CID 58364042
3-[4-[(6-butan-2-ylnaphthalen-2-yl)oxymethyl]phenoxy]sulfonyl-1,1,2,2,3,3-hexafluoropropane-1-sulfonic acid (PubChem CID 58364042) has the molecular formula C24H22F6O7S2 and a molecular weight of 600.56 g/mol. Its IUPAC name is 3-[4-[(6-butan-2-ylnaphthalen-2-yl)oxymethyl]phenoxy]sulfonyl-1,1,2,2,3,3-hexafluoropropane-1-sulfonic acid.
| Compound Name | 3-[4-[(6-butan-2-ylnaphthalen-2-yl)oxymethyl]phenoxy]sulfonyl-1,1,2,2,3,3-hexafluoropropane-1-sulfonic acid |
|---|---|
| PubChem CID | 58364042 |
| Molecular Formula | C24H22F6O7S2 |
| Molecular Weight | 600.56 g/mol |
| Exact Mass | 600.07 |
| IUPAC Name | 3-[4-[(6-butan-2-ylnaphthalen-2-yl)oxymethyl]phenoxy]sulfonyl-1,1,2,2,3,3-hexafluoropropane-1-sulfonic acid |
| SMILES | CCC(C)c1ccc2cc(OCc3ccc(OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)O)cc3)ccc2c1 |
| InChI | InChI=1S/C24H22F6O7S2/c1-3-15(2)17-6-7-19-13-21(11-8-18(19)12-17)36-14-16-4-9-20(10-5-16)37-39(34,35)24(29,30)22(25,26)23(27,28)38(31,32)33/h4-13,15H,3,14H2,1-2H3,(H,31,32,33) |
| InChIKey | MMMDAYPISPXIDM-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.56 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|