C22H16F6O7S2 — CID 58364077
3-[4-[(6-ethenylnaphthalen-2-yl)oxymethyl]phenoxy]sulfonyl-1,1,2,2,3,3-hexafluoropropane-1-sulfonic acid (PubChem CID 58364077) has the molecular formula C22H16F6O7S2 and a molecular weight of 570.49 g/mol. Its IUPAC name is 3-[4-[(6-ethenylnaphthalen-2-yl)oxymethyl]phenoxy]sulfonyl-1,1,2,2,3,3-hexafluoropropane-1-sulfonic acid.
| Compound Name | 3-[4-[(6-ethenylnaphthalen-2-yl)oxymethyl]phenoxy]sulfonyl-1,1,2,2,3,3-hexafluoropropane-1-sulfonic acid |
|---|---|
| PubChem CID | 58364077 |
| Molecular Formula | C22H16F6O7S2 |
| Molecular Weight | 570.49 g/mol |
| Exact Mass | 570.02 |
| IUPAC Name | 3-[4-[(6-ethenylnaphthalen-2-yl)oxymethyl]phenoxy]sulfonyl-1,1,2,2,3,3-hexafluoropropane-1-sulfonic acid |
| SMILES | C=Cc1ccc2cc(OCc3ccc(OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)O)cc3)ccc2c1 |
| InChI | InChI=1S/C22H16F6O7S2/c1-2-14-3-6-17-12-19(10-7-16(17)11-14)34-13-15-4-8-18(9-5-15)35-37(32,33)22(27,28)20(23,24)21(25,26)36(29,30)31/h2-12H,1,13H2,(H,29,30,31) |
| InChIKey | SXSOQMFCUPCWND-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.49 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|