C17H25F6N2O8S2- — CID 58364115
1,1,2,2,3,3-hexafluoro-3-[4-(2-hydroxy-6,6-dimethyl-5-oxooctanoyl)piperazin-1-yl]sulfonylpropane-1-sulfonate (PubChem CID 58364115) has the molecular formula C17H25F6N2O8S2- and a molecular weight of 563.52 g/mol. Its IUPAC name is 1,1,2,2,3,3-hexafluoro-3-[4-(2-hydroxy-6,6-dimethyl-5-oxooctanoyl)piperazin-1-yl]sulfonylpropane-1-sulfonate.
| Compound Name | 1,1,2,2,3,3-hexafluoro-3-[4-(2-hydroxy-6,6-dimethyl-5-oxooctanoyl)piperazin-1-yl]sulfonylpropane-1-sulfonate |
|---|---|
| PubChem CID | 58364115 |
| Molecular Formula | C17H25F6N2O8S2- |
| Molecular Weight | 563.52 g/mol |
| Exact Mass | 563.10 |
| IUPAC Name | 1,1,2,2,3,3-hexafluoro-3-[4-(2-hydroxy-6,6-dimethyl-5-oxooctanoyl)piperazin-1-yl]sulfonylpropane-1-sulfonate |
| SMILES | CCC(C)(C)C(=O)CCC(O)C(=O)N1CCN(S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)[O-])CC1 |
| InChI | InChI=1S/C17H26F6N2O8S2/c1-4-14(2,3)12(27)6-5-11(26)13(28)24-7-9-25(10-8-24)34(29,30)16(20,21)15(18,19)17(22,23)35(31,32)33/h11,26H,4-10H2,1-3H3,(H,31,32,33)/p-1 |
| InChIKey | KZMHOGVMFBTTMO-UHFFFAOYSA-M |
| XLogP | 0.97 |
| TPSA | 152.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.52 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|