C20H16F6O11S3 — CID 58364122
3-[4-[2-(4-ethenylphenoxy)sulfonylethoxycarbonyl]phenoxy]sulfonyl-1,1,2,2,3,3-hexafluoropropane-1-sulfonic acid (PubChem CID 58364122) has the molecular formula C20H16F6O11S3 and a molecular weight of 642.53 g/mol. Its IUPAC name is 3-[4-[2-(4-ethenylphenoxy)sulfonylethoxycarbonyl]phenoxy]sulfonyl-1,1,2,2,3,3-hexafluoropropane-1-sulfonic acid.
| Compound Name | 3-[4-[2-(4-ethenylphenoxy)sulfonylethoxycarbonyl]phenoxy]sulfonyl-1,1,2,2,3,3-hexafluoropropane-1-sulfonic acid |
|---|---|
| PubChem CID | 58364122 |
| Molecular Formula | C20H16F6O11S3 |
| Molecular Weight | 642.53 g/mol |
| Exact Mass | 641.98 |
| IUPAC Name | 3-[4-[2-(4-ethenylphenoxy)sulfonylethoxycarbonyl]phenoxy]sulfonyl-1,1,2,2,3,3-hexafluoropropane-1-sulfonic acid |
| SMILES | C=Cc1ccc(OS(=O)(=O)CCOC(=O)c2ccc(OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)O)cc2)cc1 |
| InChI | InChI=1S/C20H16F6O11S3/c1-2-13-3-7-15(8-4-13)36-38(28,29)12-11-35-17(27)14-5-9-16(10-6-14)37-40(33,34)20(25,26)18(21,22)19(23,24)39(30,31)32/h2-10H,1,11-12H2,(H,30,31,32) |
| InChIKey | DQSDAVAHCBRFBX-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 167.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.53 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|