C21H19F6O8S2- — CID 58364136
3-[4-[(4-butan-2-ylbenzoyl)oxymethyl]phenoxy]sulfonyl-1,1,2,2,3,3-hexafluoropropane-1-sulfonate (PubChem CID 58364136) has the molecular formula C21H19F6O8S2- and a molecular weight of 577.50 g/mol. Its IUPAC name is 3-[4-[(4-butan-2-ylbenzoyl)oxymethyl]phenoxy]sulfonyl-1,1,2,2,3,3-hexafluoropropane-1-sulfonate.
| Compound Name | 3-[4-[(4-butan-2-ylbenzoyl)oxymethyl]phenoxy]sulfonyl-1,1,2,2,3,3-hexafluoropropane-1-sulfonate |
|---|---|
| PubChem CID | 58364136 |
| Molecular Formula | C21H19F6O8S2- |
| Molecular Weight | 577.50 g/mol |
| Exact Mass | 577.04 |
| IUPAC Name | 3-[4-[(4-butan-2-ylbenzoyl)oxymethyl]phenoxy]sulfonyl-1,1,2,2,3,3-hexafluoropropane-1-sulfonate |
| SMILES | CCC(C)c1ccc(C(=O)OCc2ccc(OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C21H20F6O8S2/c1-3-13(2)15-6-8-16(9-7-15)18(28)34-12-14-4-10-17(11-5-14)35-37(32,33)21(26,27)19(22,23)20(24,25)36(29,30)31/h4-11,13H,3,12H2,1-2H3,(H,29,30,31)/p-1 |
| InChIKey | DEGIPRQFRGYCMM-UHFFFAOYSA-M |
| XLogP | 4.63 |
| TPSA | 126.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.50 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|