C17H14F4O5S — CID 58364161
4-(4-butan-2-ylbenzoyl)oxy-2,3,5,6-tetrafluorobenzenesulfonic acid (PubChem CID 58364161) has the molecular formula C17H14F4O5S and a molecular weight of 406.35 g/mol. Its IUPAC name is 4-(4-butan-2-ylbenzoyl)oxy-2,3,5,6-tetrafluorobenzenesulfonic acid.
| Compound Name | 4-(4-butan-2-ylbenzoyl)oxy-2,3,5,6-tetrafluorobenzenesulfonic acid |
|---|---|
| PubChem CID | 58364161 |
| Molecular Formula | C17H14F4O5S |
| Molecular Weight | 406.35 g/mol |
| Exact Mass | 406.05 |
| IUPAC Name | 4-(4-butan-2-ylbenzoyl)oxy-2,3,5,6-tetrafluorobenzenesulfonic acid |
| SMILES | CCC(C)c1ccc(C(=O)Oc2c(F)c(F)c(S(=O)(=O)O)c(F)c2F)cc1 |
| InChI | InChI=1S/C17H14F4O5S/c1-3-8(2)9-4-6-10(7-5-9)17(22)26-15-11(18)13(20)16(27(23,24)25)14(21)12(15)19/h4-8H,3H2,1-2H3,(H,23,24,25) |
| InChIKey | BAPZYZSTVOYKRM-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.35 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|