C16H20BrN3OSi — CID 58364943
2-[(4-bromo-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-8-yl)methoxy]ethyl-trimethylsilane (PubChem CID 58364943) has the molecular formula C16H20BrN3OSi and a molecular weight of 378.35 g/mol. Its IUPAC name is 2-[(4-bromo-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-8-yl)methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[(4-bromo-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-8-yl)methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 58364943 |
| Molecular Formula | C16H20BrN3OSi |
| Molecular Weight | 378.35 g/mol |
| Exact Mass | 377.06 |
| IUPAC Name | 2-[(4-bromo-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-8-yl)methoxy]ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCOCn1c2cnc(Br)cc2c2cccnc21 |
| InChI | InChI=1S/C16H20BrN3OSi/c1-22(2,3)8-7-21-11-20-14-10-19-15(17)9-13(14)12-5-4-6-18-16(12)20/h4-6,9-10H,7-8,11H2,1-3H3 |
| InChIKey | ZFQUCARQXZTGER-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.35 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|