C18H18ClFN6 — CID 58364967
12-chloro-13-[(3S)-3-(3-fluoropropylamino)pyrrolidin-1-yl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaene-4-carbonitrile (PubChem CID 58364967) has the molecular formula C18H18ClFN6 and a molecular weight of 372.84 g/mol. Its IUPAC name is 12-chloro-13-[(3S)-3-(3-fluoropropylamino)pyrrolidin-1-yl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaene-4-carbonitrile.
| Compound Name | 12-chloro-13-[(3S)-3-(3-fluoropropylamino)pyrrolidin-1-yl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaene-4-carbonitrile |
|---|---|
| PubChem CID | 58364967 |
| Molecular Formula | C18H18ClFN6 |
| Molecular Weight | 372.84 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | 12-chloro-13-[(3S)-3-(3-fluoropropylamino)pyrrolidin-1-yl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaene-4-carbonitrile |
| SMILES | N#Cc1cc2c(cn1)[nH]c1ncc(Cl)c(N3CC[C@H](NCCCF)C3)c12 |
| InChI | InChI=1S/C18H18ClFN6/c19-14-8-24-18-16(13-6-12(7-21)23-9-15(13)25-18)17(14)26-5-2-11(10-26)22-4-1-3-20/h6,8-9,11,22H,1-5,10H2,(H,24,25)/t11-/m0/s1 |
| InChIKey | GLNJKSKFSBZCPB-NSHDSACASA-N |
| XLogP | 3.16 |
| TPSA | 80.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.84 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|