C18H17F2N5O — CID 58365006
3-[1-(2,2-difluoroethyl)piperidin-4-yl]oxy-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene-4-carbonitrile (PubChem CID 58365006) has the molecular formula C18H17F2N5O and a molecular weight of 357.36 g/mol. Its IUPAC name is 3-[1-(2,2-difluoroethyl)piperidin-4-yl]oxy-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene-4-carbonitrile.
| Compound Name | 3-[1-(2,2-difluoroethyl)piperidin-4-yl]oxy-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene-4-carbonitrile |
|---|---|
| PubChem CID | 58365006 |
| Molecular Formula | C18H17F2N5O |
| Molecular Weight | 357.36 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | 3-[1-(2,2-difluoroethyl)piperidin-4-yl]oxy-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene-4-carbonitrile |
| SMILES | N#Cc1ncc2[nH]c3ncccc3c2c1OC1CCN(CC(F)F)CC1 |
| InChI | InChI=1S/C18H17F2N5O/c19-15(20)10-25-6-3-11(4-7-25)26-17-13(8-21)23-9-14-16(17)12-2-1-5-22-18(12)24-14/h1-2,5,9,11,15H,3-4,6-7,10H2,(H,22,24) |
| InChIKey | RBVVHUCGPVGESG-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 77.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.36 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |