C19H21N5O — CID 58365168
3-(1-ethylpiperidin-4-yl)oxy-12-methyl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene-4-carbonitrile (PubChem CID 58365168) has the molecular formula C19H21N5O and a molecular weight of 335.41 g/mol. Its IUPAC name is 3-(1-ethylpiperidin-4-yl)oxy-12-methyl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene-4-carbonitrile.
| Compound Name | 3-(1-ethylpiperidin-4-yl)oxy-12-methyl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene-4-carbonitrile |
|---|---|
| PubChem CID | 58365168 |
| Molecular Formula | C19H21N5O |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | 3-(1-ethylpiperidin-4-yl)oxy-12-methyl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene-4-carbonitrile |
| SMILES | CCN1CCC(Oc2c(C#N)ncc3[nH]c4ncc(C)cc4c23)CC1 |
| InChI | InChI=1S/C19H21N5O/c1-3-24-6-4-13(5-7-24)25-18-15(9-20)21-11-16-17(18)14-8-12(2)10-22-19(14)23-16/h8,10-11,13H,3-7H2,1-2H3,(H,22,23) |
| InChIKey | WPWDZOCRBVSOSS-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 77.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |