C28H39BrN6O3Si — CID 58365177
tert-butyl N-[(3S)-1-[12-bromo-4-cyano-8-(2-trimethylsilylethoxymethyl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaen-13-yl]pyrrolidin-3-yl]-N-ethylcarbamate (PubChem CID 58365177) has the molecular formula C28H39BrN6O3Si and a molecular weight of 615.65 g/mol. Its IUPAC name is tert-butyl N-[(3S)-1-[12-bromo-4-cyano-8-(2-trimethylsilylethoxymethyl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaen-13-yl]pyrrolidin-3-yl]-N-ethylcarbamate.
| Compound Name | tert-butyl N-[(3S)-1-[12-bromo-4-cyano-8-(2-trimethylsilylethoxymethyl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaen-13-yl]pyrrolidin-3-yl]-N-ethylcarbamate |
|---|---|
| PubChem CID | 58365177 |
| Molecular Formula | C28H39BrN6O3Si |
| Molecular Weight | 615.65 g/mol |
| Exact Mass | 614.20 |
| IUPAC Name | tert-butyl N-[(3S)-1-[12-bromo-4-cyano-8-(2-trimethylsilylethoxymethyl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaen-13-yl]pyrrolidin-3-yl]-N-ethylcarbamate |
| SMILES | CCN(C(=O)OC(C)(C)C)[C@H]1CCN(c2c(Br)cnc3c2c2cc(C#N)ncc2n3COCC[Si](C)(C)C)C1 |
| InChI | InChI=1S/C28H39BrN6O3Si/c1-8-34(27(36)38-28(2,3)4)20-9-10-33(17-20)25-22(29)15-32-26-24(25)21-13-19(14-30)31-16-23(21)35(26)18-37-11-12-39(5,6)7/h13,15-16,20H,8-12,17-18H2,1-7H3/t20-/m0/s1 |
| InChIKey | JXOYGTUGTVRZOJ-FQEVSTJZSA-N |
| XLogP | 6.37 |
| TPSA | 96.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.65 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|