C24H22N4O2S — CID 58365334
3-tert-butyl-4-(1-oxidopyridin-1-ium-2-yl)-5-(4-thiophen-3-ylphenyl)-2,4-dihydropyrrolo[3,4-c]pyrazol-6-one (PubChem CID 58365334) has the molecular formula C24H22N4O2S and a molecular weight of 430.53 g/mol. Its IUPAC name is 3-tert-butyl-4-(1-oxidopyridin-1-ium-2-yl)-5-(4-thiophen-3-ylphenyl)-2,4-dihydropyrrolo[3,4-c]pyrazol-6-one.
| Compound Name | 3-tert-butyl-4-(1-oxidopyridin-1-ium-2-yl)-5-(4-thiophen-3-ylphenyl)-2,4-dihydropyrrolo[3,4-c]pyrazol-6-one |
|---|---|
| PubChem CID | 58365334 |
| Molecular Formula | C24H22N4O2S |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | 3-tert-butyl-4-(1-oxidopyridin-1-ium-2-yl)-5-(4-thiophen-3-ylphenyl)-2,4-dihydropyrrolo[3,4-c]pyrazol-6-one |
| SMILES | CC(C)(C)c1[nH]nc2c1C(c1cccc[n+]1[O-])N(c1ccc(-c3ccsc3)cc1)C2=O |
| InChI | InChI=1S/C24H22N4O2S/c1-24(2,3)22-19-20(25-26-22)23(29)28(21(19)18-6-4-5-12-27(18)30)17-9-7-15(8-10-17)16-11-13-31-14-16/h4-14,21H,1-3H3,(H,25,26) |
| InChIKey | YWAJAOSMBKUQGW-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 75.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|