C26H26N2O6 — CID 58365902
4-hydroxy-2-[2-(2-methoxyethoxy)phenyl]-3-(2-methylpropanoyl)-1-[4-(1,2-oxazol-3-yl)phenyl]-2H-pyrrol-5-one (PubChem CID 58365902) has the molecular formula C26H26N2O6 and a molecular weight of 462.50 g/mol. Its IUPAC name is 4-hydroxy-2-[2-(2-methoxyethoxy)phenyl]-3-(2-methylpropanoyl)-1-[4-(1,2-oxazol-3-yl)phenyl]-2H-pyrrol-5-one.
| Compound Name | 4-hydroxy-2-[2-(2-methoxyethoxy)phenyl]-3-(2-methylpropanoyl)-1-[4-(1,2-oxazol-3-yl)phenyl]-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 58365902 |
| Molecular Formula | C26H26N2O6 |
| Molecular Weight | 462.50 g/mol |
| Exact Mass | 462.18 |
| IUPAC Name | 4-hydroxy-2-[2-(2-methoxyethoxy)phenyl]-3-(2-methylpropanoyl)-1-[4-(1,2-oxazol-3-yl)phenyl]-2H-pyrrol-5-one |
| SMILES | COCCOc1ccccc1C1C(C(=O)C(C)C)=C(O)C(=O)N1c1ccc(-c2ccon2)cc1 |
| InChI | InChI=1S/C26H26N2O6/c1-16(2)24(29)22-23(19-6-4-5-7-21(19)33-15-14-32-3)28(26(31)25(22)30)18-10-8-17(9-11-18)20-12-13-34-27-20/h4-13,16,23,30H,14-15H2,1-3H3 |
| InChIKey | SSTSXSGKVLGPRF-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 102.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.50 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|