C26H38N4OSi — CID 58366193
tert-butyl-dimethyl-[7-phenyl-1-(3-pyridin-2-yl-1H-1,2,4-triazol-5-yl)heptoxy]silane (PubChem CID 58366193) has the molecular formula C26H38N4OSi and a molecular weight of 450.70 g/mol. Its IUPAC name is tert-butyl-dimethyl-[7-phenyl-1-(3-pyridin-2-yl-1H-1,2,4-triazol-5-yl)heptoxy]silane.
| Compound Name | tert-butyl-dimethyl-[7-phenyl-1-(3-pyridin-2-yl-1H-1,2,4-triazol-5-yl)heptoxy]silane |
|---|---|
| PubChem CID | 58366193 |
| Molecular Formula | C26H38N4OSi |
| Molecular Weight | 450.70 g/mol |
| Exact Mass | 450.28 |
| IUPAC Name | tert-butyl-dimethyl-[7-phenyl-1-(3-pyridin-2-yl-1H-1,2,4-triazol-5-yl)heptoxy]silane |
| SMILES | CC(C)(C)[Si](C)(C)OC(CCCCCCc1ccccc1)c1nc(-c2ccccn2)n[nH]1 |
| InChI | InChI=1S/C26H38N4OSi/c1-26(2,3)32(4,5)31-23(19-12-7-6-9-15-21-16-10-8-11-17-21)25-28-24(29-30-25)22-18-13-14-20-27-22/h8,10-11,13-14,16-18,20,23H,6-7,9,12,15,19H2,1-5H3,(H,28,29,30) |
| InChIKey | NDEYFTADKIIIBG-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.70 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|