C26H27F3N6O2 — CID 58366477
3-[4-(1,5-dimethylpyrazol-4-yl)triazol-1-yl]-N-[4-(3-methoxypropyl)-3-(trifluoromethyl)phenyl]-4-methylbenzamide (PubChem CID 58366477) has the molecular formula C26H27F3N6O2 and a molecular weight of 512.54 g/mol. Its IUPAC name is 3-[4-(1,5-dimethylpyrazol-4-yl)triazol-1-yl]-N-[4-(3-methoxypropyl)-3-(trifluoromethyl)phenyl]-4-methylbenzamide.
| Compound Name | 3-[4-(1,5-dimethylpyrazol-4-yl)triazol-1-yl]-N-[4-(3-methoxypropyl)-3-(trifluoromethyl)phenyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 58366477 |
| Molecular Formula | C26H27F3N6O2 |
| Molecular Weight | 512.54 g/mol |
| Exact Mass | 512.21 |
| IUPAC Name | 3-[4-(1,5-dimethylpyrazol-4-yl)triazol-1-yl]-N-[4-(3-methoxypropyl)-3-(trifluoromethyl)phenyl]-4-methylbenzamide |
| SMILES | COCCCc1ccc(NC(=O)c2ccc(C)c(-n3cc(-c4cnn(C)c4C)nn3)c2)cc1C(F)(F)F |
| InChI | InChI=1S/C26H27F3N6O2/c1-16-7-8-19(12-24(16)35-15-23(32-33-35)21-14-30-34(3)17(21)2)25(36)31-20-10-9-18(6-5-11-37-4)22(13-20)26(27,28)29/h7-10,12-15H,5-6,11H2,1-4H3,(H,31,36) |
| InChIKey | HTRXWISMMWYXPR-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 86.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.54 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|