C29H31F3N6O2 — CID 58366539
N-[3-[4-(dimethylamino)butyl]-2-methoxy-5-(trifluoromethyl)phenyl]-4-methyl-3-(4-pyridin-3-yltriazol-1-yl)benzamide (PubChem CID 58366539) has the molecular formula C29H31F3N6O2 and a molecular weight of 552.60 g/mol. Its IUPAC name is N-[3-[4-(dimethylamino)butyl]-2-methoxy-5-(trifluoromethyl)phenyl]-4-methyl-3-(4-pyridin-3-yltriazol-1-yl)benzamide.
| Compound Name | N-[3-[4-(dimethylamino)butyl]-2-methoxy-5-(trifluoromethyl)phenyl]-4-methyl-3-(4-pyridin-3-yltriazol-1-yl)benzamide |
|---|---|
| PubChem CID | 58366539 |
| Molecular Formula | C29H31F3N6O2 |
| Molecular Weight | 552.60 g/mol |
| Exact Mass | 552.25 |
| IUPAC Name | N-[3-[4-(dimethylamino)butyl]-2-methoxy-5-(trifluoromethyl)phenyl]-4-methyl-3-(4-pyridin-3-yltriazol-1-yl)benzamide |
| SMILES | COc1c(CCCCN(C)C)cc(C(F)(F)F)cc1NC(=O)c1ccc(C)c(-n2cc(-c3cccnc3)nn2)c1 |
| InChI | InChI=1S/C29H31F3N6O2/c1-19-10-11-21(15-26(19)38-18-25(35-36-38)22-9-7-12-33-17-22)28(39)34-24-16-23(29(30,31)32)14-20(27(24)40-4)8-5-6-13-37(2)3/h7,9-12,14-18H,5-6,8,13H2,1-4H3,(H,34,39) |
| InChIKey | JIWHPSITBHOEKV-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.60 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|