C27H30F3N7O — CID 58366646
N-[4-(butylaminomethyl)-3-(trifluoromethyl)phenyl]-3-[4-(1,5-dimethylpyrazol-4-yl)triazol-1-yl]-4-methylbenzamide (PubChem CID 58366646) has the molecular formula C27H30F3N7O and a molecular weight of 525.58 g/mol. Its IUPAC name is N-[4-(butylaminomethyl)-3-(trifluoromethyl)phenyl]-3-[4-(1,5-dimethylpyrazol-4-yl)triazol-1-yl]-4-methylbenzamide.
| Compound Name | N-[4-(butylaminomethyl)-3-(trifluoromethyl)phenyl]-3-[4-(1,5-dimethylpyrazol-4-yl)triazol-1-yl]-4-methylbenzamide |
|---|---|
| PubChem CID | 58366646 |
| Molecular Formula | C27H30F3N7O |
| Molecular Weight | 525.58 g/mol |
| Exact Mass | 525.25 |
| IUPAC Name | N-[4-(butylaminomethyl)-3-(trifluoromethyl)phenyl]-3-[4-(1,5-dimethylpyrazol-4-yl)triazol-1-yl]-4-methylbenzamide |
| SMILES | CCCCNCc1ccc(NC(=O)c2ccc(C)c(-n3cc(-c4cnn(C)c4C)nn3)c2)cc1C(F)(F)F |
| InChI | InChI=1S/C27H30F3N7O/c1-5-6-11-31-14-20-9-10-21(13-23(20)27(28,29)30)33-26(38)19-8-7-17(2)25(12-19)37-16-24(34-35-37)22-15-32-36(4)18(22)3/h7-10,12-13,15-16,31H,5-6,11,14H2,1-4H3,(H,33,38) |
| InChIKey | DIPXENFTYURTIW-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 89.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.58 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|