C28H29F3N6O2S — CID 58366760
4-methyl-N-[3-(4-morpholin-4-ylbutyl)-5-(trifluoromethyl)phenyl]-3-[4-(1,3-thiazol-5-yl)triazol-1-yl]benzamide (PubChem CID 58366760) has the molecular formula C28H29F3N6O2S and a molecular weight of 570.64 g/mol. Its IUPAC name is 4-methyl-N-[3-(4-morpholin-4-ylbutyl)-5-(trifluoromethyl)phenyl]-3-[4-(1,3-thiazol-5-yl)triazol-1-yl]benzamide.
| Compound Name | 4-methyl-N-[3-(4-morpholin-4-ylbutyl)-5-(trifluoromethyl)phenyl]-3-[4-(1,3-thiazol-5-yl)triazol-1-yl]benzamide |
|---|---|
| PubChem CID | 58366760 |
| Molecular Formula | C28H29F3N6O2S |
| Molecular Weight | 570.64 g/mol |
| Exact Mass | 570.20 |
| IUPAC Name | 4-methyl-N-[3-(4-morpholin-4-ylbutyl)-5-(trifluoromethyl)phenyl]-3-[4-(1,3-thiazol-5-yl)triazol-1-yl]benzamide |
| SMILES | Cc1ccc(C(=O)Nc2cc(CCCCN3CCOCC3)cc(C(F)(F)F)c2)cc1-n1cc(-c2cncs2)nn1 |
| InChI | InChI=1S/C28H29F3N6O2S/c1-19-5-6-21(14-25(19)37-17-24(34-35-37)26-16-32-18-40-26)27(38)33-23-13-20(12-22(15-23)28(29,30)31)4-2-3-7-36-8-10-39-11-9-36/h5-6,12-18H,2-4,7-11H2,1H3,(H,33,38) |
| InChIKey | UADPXGDEQAKJFP-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.64 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|