C24H23N3O3S — CID 58367261
2-[[(1R)-4-[2-(3-isocyano-4-propan-2-yloxyphenyl)-1,3-thiazol-5-yl]-2,3-dihydro-1H-inden-1-yl]amino]acetic acid (PubChem CID 58367261) has the molecular formula C24H23N3O3S and a molecular weight of 433.53 g/mol. Its IUPAC name is 2-[[(1R)-4-[2-(3-isocyano-4-propan-2-yloxyphenyl)-1,3-thiazol-5-yl]-2,3-dihydro-1H-inden-1-yl]amino]acetic acid.
| Compound Name | 2-[[(1R)-4-[2-(3-isocyano-4-propan-2-yloxyphenyl)-1,3-thiazol-5-yl]-2,3-dihydro-1H-inden-1-yl]amino]acetic acid |
|---|---|
| PubChem CID | 58367261 |
| Molecular Formula | C24H23N3O3S |
| Molecular Weight | 433.53 g/mol |
| Exact Mass | 433.15 |
| IUPAC Name | 2-[[(1R)-4-[2-(3-isocyano-4-propan-2-yloxyphenyl)-1,3-thiazol-5-yl]-2,3-dihydro-1H-inden-1-yl]amino]acetic acid |
| SMILES | [C-]#[N+]c1cc(-c2ncc(-c3cccc4c3CC[C@H]4NCC(=O)O)s2)ccc1OC(C)C |
| InChI | InChI=1S/C24H23N3O3S/c1-14(2)30-21-10-7-15(11-20(21)25-3)24-27-12-22(31-24)18-6-4-5-17-16(18)8-9-19(17)26-13-23(28)29/h4-7,10-12,14,19,26H,8-9,13H2,1-2H3,(H,28,29)/t19-/m1/s1 |
| InChIKey | PHRXLEQVWLQADG-LJQANCHMSA-N |
| XLogP | 5.48 |
| TPSA | 75.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.53 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|