About carbanide;(2-oxo-2-phenylethyl) propanoate;yttrium
carbanide;(2-oxo-2-phenylethyl) propanoate;yttrium (PubChem CID 58367994) has the molecular formula C12H14O3Y-2
and a molecular weight of 295.15 g/mol. Its IUPAC name is carbanide;(2-oxo-2-phenylethyl) propanoate;yttrium.
Molecular Properties
| Compound Name | carbanide;(2-oxo-2-phenylethyl) propanoate;yttrium |
| PubChem CID | 58367994 |
| Molecular Formula | C12H14O3Y-2 |
| Molecular Weight | 295.15 g/mol |
| Exact Mass | 295.00 |
| IUPAC Name | carbanide;(2-oxo-2-phenylethyl) propanoate;yttrium |
| SMILES | CCC(=O)OCC(=O)c1cc[c-]cc1.[CH3-].[Y] |
| InChI | InChI=1S/C11H11O3.CH3.Y/c1-2-11(13)14-8-10(12)9-6-4-3-5-7-9;;/h4-7H,2,8H2,1H3;1H3;/q2*-1; |
| InChIKey | MROMWKIGQRIGIG-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.15 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze carbanide;(2-oxo-2-phenylethyl) propanoate;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbanide;(2-oxo-2-phenylethyl) propanoate;yttrium?
The IUPAC name of carbanide;(2-oxo-2-phenylethyl) propanoate;yttrium (CID 58367994) is carbanide;(2-oxo-2-phenylethyl) propanoate;yttrium.
What is the SMILES notation for carbanide;(2-oxo-2-phenylethyl) propanoate;yttrium?
The canonical SMILES for carbanide;(2-oxo-2-phenylethyl) propanoate;yttrium is CCC(=O)OCC(=O)c1cc[c-]cc1.[CH3-].[Y].
What is the InChIKey of carbanide;(2-oxo-2-phenylethyl) propanoate;yttrium?
The InChIKey is MROMWKIGQRIGIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11O3.CH3.Y/c1-2-11(13)14-8-10(12)9-6-4-3-5-7-9;;/h4-7H,2,8H2,1H3;1H3;/q2*-1;.
What are the key properties of carbanide;(2-oxo-2-phenylethyl) propanoate;yttrium?
carbanide;(2-oxo-2-phenylethyl) propanoate;yttrium has a molecular weight of 295.15 g/mol, XLogP of 2.07, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for carbanide;(2-oxo-2-phenylethyl) propanoate;yttrium is sourced from PubChem (CID 58367994), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).