About N-(3,3-dimethylbutyl)-6-[(3-fluorophenyl)methoxy]-2-methylpyridine-3-carboxamide
N-(3,3-dimethylbutyl)-6-[(3-fluorophenyl)methoxy]-2-methylpyridine-3-carboxamide (PubChem CID 58368094) has the molecular formula C20H25FN2O2
and a molecular weight of 344.43 g/mol. Its IUPAC name is N-(3,3-dimethylbutyl)-6-[(3-fluorophenyl)methoxy]-2-methylpyridine-3-carboxamide.
Molecular Properties
| Compound Name | N-(3,3-dimethylbutyl)-6-[(3-fluorophenyl)methoxy]-2-methylpyridine-3-carboxamide |
| PubChem CID | 58368094 |
| Molecular Formula | C20H25FN2O2 |
| Molecular Weight | 344.43 g/mol |
| Exact Mass | 344.19 |
| IUPAC Name | N-(3,3-dimethylbutyl)-6-[(3-fluorophenyl)methoxy]-2-methylpyridine-3-carboxamide |
| SMILES | Cc1nc(OCc2cccc(F)c2)ccc1C(=O)NCCC(C)(C)C |
| InChI | InChI=1S/C20H25FN2O2/c1-14-17(19(24)22-11-10-20(2,3)4)8-9-18(23-14)25-13-15-6-5-7-16(21)12-15/h5-9,12H,10-11,13H2,1-4H3,(H,22,24) |
| InChIKey | GBFQBVLQHIKVKL-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.43 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(3,3-dimethylbutyl)-6-[(3-fluorophenyl)methoxy]-2-methylpyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,3-dimethylbutyl)-6-[(3-fluorophenyl)methoxy]-2-methylpyridine-3-carboxamide?
The IUPAC name of N-(3,3-dimethylbutyl)-6-[(3-fluorophenyl)methoxy]-2-methylpyridine-3-carboxamide (CID 58368094) is N-(3,3-dimethylbutyl)-6-[(3-fluorophenyl)methoxy]-2-methylpyridine-3-carboxamide.
What is the SMILES notation for N-(3,3-dimethylbutyl)-6-[(3-fluorophenyl)methoxy]-2-methylpyridine-3-carboxamide?
The canonical SMILES for N-(3,3-dimethylbutyl)-6-[(3-fluorophenyl)methoxy]-2-methylpyridine-3-carboxamide is Cc1nc(OCc2cccc(F)c2)ccc1C(=O)NCCC(C)(C)C.
What is the InChIKey of N-(3,3-dimethylbutyl)-6-[(3-fluorophenyl)methoxy]-2-methylpyridine-3-carboxamide?
The InChIKey is GBFQBVLQHIKVKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H25FN2O2/c1-14-17(19(24)22-11-10-20(2,3)4)8-9-18(23-14)25-13-15-6-5-7-16(21)12-15/h5-9,12H,10-11,13H2,1-4H3,(H,22,24).
What are the key properties of N-(3,3-dimethylbutyl)-6-[(3-fluorophenyl)methoxy]-2-methylpyridine-3-carboxamide?
N-(3,3-dimethylbutyl)-6-[(3-fluorophenyl)methoxy]-2-methylpyridine-3-carboxamide has a molecular weight of 344.43 g/mol, XLogP of 4.27, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,3-dimethylbutyl)-6-[(3-fluorophenyl)methoxy]-2-methylpyridine-3-carboxamide is sourced from PubChem (CID 58368094), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).