About N'-(2-propan-2-yl-1,3-oxazol-5-yl)ethane-1,2-diamine
N'-(2-propan-2-yl-1,3-oxazol-5-yl)ethane-1,2-diamine (PubChem CID 58368290) has the molecular formula C8H15N3O
and a molecular weight of 169.23 g/mol. Its IUPAC name is N'-(2-propan-2-yl-1,3-oxazol-5-yl)ethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-(2-propan-2-yl-1,3-oxazol-5-yl)ethane-1,2-diamine |
| PubChem CID | 58368290 |
| Molecular Formula | C8H15N3O |
| Molecular Weight | 169.23 g/mol |
| Exact Mass | 169.12 |
| IUPAC Name | N'-(2-propan-2-yl-1,3-oxazol-5-yl)ethane-1,2-diamine |
| SMILES | CC(C)c1ncc(NCCN)o1 |
| InChI | InChI=1S/C8H15N3O/c1-6(2)8-11-5-7(12-8)10-4-3-9/h5-6,10H,3-4,9H2,1-2H3 |
| InChIKey | SIIOXEUHQLPAKT-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.23 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N'-(2-propan-2-yl-1,3-oxazol-5-yl)ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(2-propan-2-yl-1,3-oxazol-5-yl)ethane-1,2-diamine?
The IUPAC name of N'-(2-propan-2-yl-1,3-oxazol-5-yl)ethane-1,2-diamine (CID 58368290) is N'-(2-propan-2-yl-1,3-oxazol-5-yl)ethane-1,2-diamine.
What is the SMILES notation for N'-(2-propan-2-yl-1,3-oxazol-5-yl)ethane-1,2-diamine?
The canonical SMILES for N'-(2-propan-2-yl-1,3-oxazol-5-yl)ethane-1,2-diamine is CC(C)c1ncc(NCCN)o1.
What is the InChIKey of N'-(2-propan-2-yl-1,3-oxazol-5-yl)ethane-1,2-diamine?
The InChIKey is SIIOXEUHQLPAKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N3O/c1-6(2)8-11-5-7(12-8)10-4-3-9/h5-6,10H,3-4,9H2,1-2H3.
What are the key properties of N'-(2-propan-2-yl-1,3-oxazol-5-yl)ethane-1,2-diamine?
N'-(2-propan-2-yl-1,3-oxazol-5-yl)ethane-1,2-diamine has a molecular weight of 169.23 g/mol, XLogP of 1.17, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(2-propan-2-yl-1,3-oxazol-5-yl)ethane-1,2-diamine is sourced from PubChem (CID 58368290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).