C17H21F3O5 — CID 58369059
6-[5-[4-(trifluoromethoxy)phenoxy]-1,3-dioxan-2-yl]hexan-2-one (PubChem CID 58369059) has the molecular formula C17H21F3O5 and a molecular weight of 362.34 g/mol. Its IUPAC name is 6-[5-[4-(trifluoromethoxy)phenoxy]-1,3-dioxan-2-yl]hexan-2-one.
| Compound Name | 6-[5-[4-(trifluoromethoxy)phenoxy]-1,3-dioxan-2-yl]hexan-2-one |
|---|---|
| PubChem CID | 58369059 |
| Molecular Formula | C17H21F3O5 |
| Molecular Weight | 362.34 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | 6-[5-[4-(trifluoromethoxy)phenoxy]-1,3-dioxan-2-yl]hexan-2-one |
| SMILES | CC(=O)CCCCC1OCC(Oc2ccc(OC(F)(F)F)cc2)CO1 |
| InChI | InChI=1S/C17H21F3O5/c1-12(21)4-2-3-5-16-22-10-15(11-23-16)24-13-6-8-14(9-7-13)25-17(18,19)20/h6-9,15-16H,2-5,10-11H2,1H3 |
| InChIKey | SLGWBDNNXSKNIN-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.34 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|