C28H38FN3OS — CID 58369680
(E)-1-[4-[2-[[(6S)-2-amino-4,5,6,7-tetrahydro-1,3-benzothiazol-6-yl]-propylamino]ethyl]cyclohexyl]-4-(3-fluorophenyl)but-3-en-2-one (PubChem CID 58369680) has the molecular formula C28H38FN3OS and a molecular weight of 483.70 g/mol. Its IUPAC name is (E)-1-[4-[2-[[(6S)-2-amino-4,5,6,7-tetrahydro-1,3-benzothiazol-6-yl]-propylamino]ethyl]cyclohexyl]-4-(3-fluorophenyl)but-3-en-2-one.
| Compound Name | (E)-1-[4-[2-[[(6S)-2-amino-4,5,6,7-tetrahydro-1,3-benzothiazol-6-yl]-propylamino]ethyl]cyclohexyl]-4-(3-fluorophenyl)but-3-en-2-one |
|---|---|
| PubChem CID | 58369680 |
| Molecular Formula | C28H38FN3OS |
| Molecular Weight | 483.70 g/mol |
| Exact Mass | 483.27 |
| IUPAC Name | (E)-1-[4-[2-[[(6S)-2-amino-4,5,6,7-tetrahydro-1,3-benzothiazol-6-yl]-propylamino]ethyl]cyclohexyl]-4-(3-fluorophenyl)but-3-en-2-one |
| SMILES | CCCN(CCC1CCC(CC(=O)/C=C/c2cccc(F)c2)CC1)[C@H]1CCc2nc(N)sc2C1 |
| InChI | InChI=1S/C28H38FN3OS/c1-2-15-32(24-11-13-26-27(19-24)34-28(30)31-26)16-14-20-6-8-22(9-7-20)18-25(33)12-10-21-4-3-5-23(29)17-21/h3-5,10,12,17,20,22,24H,2,6-9,11,13-16,18-19H2,1H3,(H2,30,31)/b12-10+/t20?,22?,24-/m0/s1 |
| InChIKey | RMTIKSHJGMFZEB-KKSOWQSFSA-N |
| XLogP | 6.30 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.70 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|