C29H39N3O2S2 — CID 58369708
(6S)-6-N-[2-[4-(naphthalen-1-ylsulfonylmethyl)cyclohexyl]ethyl]-6-N-propyl-4,5,6,7-tetrahydro-1,3-benzothiazole-2,6-diamine (PubChem CID 58369708) has the molecular formula C29H39N3O2S2 and a molecular weight of 525.78 g/mol. Its IUPAC name is (6S)-6-N-[2-[4-(naphthalen-1-ylsulfonylmethyl)cyclohexyl]ethyl]-6-N-propyl-4,5,6,7-tetrahydro-1,3-benzothiazole-2,6-diamine.
| Compound Name | (6S)-6-N-[2-[4-(naphthalen-1-ylsulfonylmethyl)cyclohexyl]ethyl]-6-N-propyl-4,5,6,7-tetrahydro-1,3-benzothiazole-2,6-diamine |
|---|---|
| PubChem CID | 58369708 |
| Molecular Formula | C29H39N3O2S2 |
| Molecular Weight | 525.78 g/mol |
| Exact Mass | 525.25 |
| IUPAC Name | (6S)-6-N-[2-[4-(naphthalen-1-ylsulfonylmethyl)cyclohexyl]ethyl]-6-N-propyl-4,5,6,7-tetrahydro-1,3-benzothiazole-2,6-diamine |
| SMILES | CCCN(CCC1CCC(CS(=O)(=O)c2cccc3ccccc23)CC1)[C@H]1CCc2nc(N)sc2C1 |
| InChI | InChI=1S/C29H39N3O2S2/c1-2-17-32(24-14-15-26-27(19-24)35-29(30)31-26)18-16-21-10-12-22(13-11-21)20-36(33,34)28-9-5-7-23-6-3-4-8-25(23)28/h3-9,21-22,24H,2,10-20H2,1H3,(H2,30,31)/t21?,22?,24-/m0/s1 |
| InChIKey | LILQYCVPBYMILK-IWAAJCSBSA-N |
| XLogP | 6.12 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.78 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |